About 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol
3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol (PubChem CID 65176982) has the molecular formula C16H22O
and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol |
| PubChem CID | 65176982 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol |
| SMILES | Cc1ccc(C2=CC(O)CC(C)(C)C2)c(C)c1 |
| InChI | InChI=1S/C16H22O/c1-11-5-6-15(12(2)7-11)13-8-14(17)10-16(3,4)9-13/h5-8,14,17H,9-10H2,1-4H3 |
| InChIKey | QTHWEIDMGNCJOG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol?
The IUPAC name of 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol (CID 65176982) is 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol.
What is the SMILES notation for 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol?
The canonical SMILES for 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol is Cc1ccc(C2=CC(O)CC(C)(C)C2)c(C)c1.
What is the InChIKey of 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol?
The InChIKey is QTHWEIDMGNCJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O/c1-11-5-6-15(12(2)7-11)13-8-14(17)10-16(3,4)9-13/h5-8,14,17H,9-10H2,1-4H3.
What are the key properties of 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol?
3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol has a molecular weight of 230.35 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylphenyl)-5,5-dimethylcyclohex-2-en-1-ol is sourced from PubChem (CID 65176982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).