C13H19F3O2 — CID 65177290
5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-one (PubChem CID 65177290) has the molecular formula C13H19F3O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-one.
| Compound Name | 5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 65177290 |
| Molecular Formula | C13H19F3O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C=C(CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H19F3O2/c1-12(2)7-10(6-11(17)8-12)4-3-5-18-9-13(14,15)16/h6H,3-5,7-9H2,1-2H3 |
| InChIKey | AIHMGBZCCGEMLK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|