C13H22F3NO — CID 65177475
5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-amine (PubChem CID 65177475) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is 5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-amine.
| Compound Name | 5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 65177475 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 5,5-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclohex-2-en-1-amine |
| SMILES | CC1(C)CC(CCCOCC(F)(F)F)=CC(N)C1 |
| InChI | InChI=1S/C13H22F3NO/c1-12(2)7-10(6-11(17)8-12)4-3-5-18-9-13(14,15)16/h6,11H,3-5,7-9,17H2,1-2H3 |
| InChIKey | BAORIGNXEFTVIK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|