C18H28N2O — CID 65178002
N-[[1-(3-ethoxypropyl)indol-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 65178002) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[[1-(3-ethoxypropyl)indol-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(3-ethoxypropyl)indol-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 65178002 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[[1-(3-ethoxypropyl)indol-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CCOCCCn1c(CNCC(C)C)cc2ccccc21 |
| InChI | InChI=1S/C18H28N2O/c1-4-21-11-7-10-20-17(14-19-13-15(2)3)12-16-8-5-6-9-18(16)20/h5-6,8-9,12,15,19H,4,7,10-11,13-14H2,1-3H3 |
| InChIKey | BWVBUAWULVMCDJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|