C12H22N2O — CID 65178751
2-[5-(2,3,3-trimethylbutyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65178751) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-[5-(2,3,3-trimethylbutyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 2-[5-(2,3,3-trimethylbutyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 65178751 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-[5-(2,3,3-trimethylbutyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CC(Cc1cnc(CCN)o1)C(C)(C)C |
| InChI | InChI=1S/C12H22N2O/c1-9(12(2,3)4)7-10-8-14-11(15-10)5-6-13/h8-9H,5-7,13H2,1-4H3 |
| InChIKey | APJDSYHFXXBCHQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |