About 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine
1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine (PubChem CID 65179044) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine |
| PubChem CID | 65179044 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine |
| SMILES | CNCc1ncc(-c2ccco2)o1 |
| InChI | InChI=1S/C9H10N2O2/c1-10-6-9-11-5-8(13-9)7-3-2-4-12-7/h2-5,10H,6H2,1H3 |
| InChIKey | CHEWDVJVGMQGRF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine?
The IUPAC name of 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine (CID 65179044) is 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine?
The canonical SMILES for 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine is CNCc1ncc(-c2ccco2)o1.
What is the InChIKey of 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine?
The InChIKey is CHEWDVJVGMQGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-10-6-9-11-5-8(13-9)7-3-2-4-12-7/h2-5,10H,6H2,1H3.
What are the key properties of 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine?
1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine has a molecular weight of 178.19 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylmethanamine is sourced from PubChem (CID 65179044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).