About 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine
1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65179175) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine |
| PubChem CID | 65179175 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | COCCc1cnc(C(C)N)o1 |
| InChI | InChI=1S/C8H14N2O2/c1-6(9)8-10-5-7(12-8)3-4-11-2/h5-6H,3-4,9H2,1-2H3 |
| InChIKey | IAPUWLVYPDXOOV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine?
The IUPAC name of 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine (CID 65179175) is 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine.
What is the SMILES notation for 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine?
The canonical SMILES for 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine is COCCc1cnc(C(C)N)o1.
What is the InChIKey of 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine?
The InChIKey is IAPUWLVYPDXOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6(9)8-10-5-7(12-8)3-4-11-2/h5-6H,3-4,9H2,1-2H3.
What are the key properties of 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine?
1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine has a molecular weight of 170.21 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-methoxyethyl)-1,3-oxazol-2-yl]ethanamine is sourced from PubChem (CID 65179175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).