C10H18N2O — CID 65179243
2-(5-pentan-2-yl-1,3-oxazol-2-yl)ethanamine (PubChem CID 65179243) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-(5-pentan-2-yl-1,3-oxazol-2-yl)ethanamine.
| Compound Name | 2-(5-pentan-2-yl-1,3-oxazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 65179243 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-(5-pentan-2-yl-1,3-oxazol-2-yl)ethanamine |
| SMILES | CCCC(C)c1cnc(CCN)o1 |
| InChI | InChI=1S/C10H18N2O/c1-3-4-8(2)9-7-12-10(13-9)5-6-11/h7-8H,3-6,11H2,1-2H3 |
| InChIKey | NWXXGBAPFFKNQV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |