About 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione
4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione (PubChem CID 651812) has the molecular formula C20H17N3O4
and a molecular weight of 363.37 g/mol. Its IUPAC name is 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione |
| PubChem CID | 651812 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2cccc(NCCCN3C(=O)c4ccccc4C3=O)c2C1=O |
| InChI | InChI=1S/C20H17N3O4/c1-22-17(24)14-8-4-9-15(16(14)20(22)27)21-10-5-11-23-18(25)12-6-2-3-7-13(12)19(23)26/h2-4,6-9,21H,5,10-11H2,1H3 |
| InChIKey | VDIAQKCISZOWEH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione?
The IUPAC name of 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione (CID 651812) is 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione.
What is the SMILES notation for 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione?
The canonical SMILES for 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione is CN1C(=O)c2cccc(NCCCN3C(=O)c4ccccc4C3=O)c2C1=O.
What is the InChIKey of 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione?
The InChIKey is VDIAQKCISZOWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O4/c1-22-17(24)14-8-4-9-15(16(14)20(22)27)21-10-5-11-23-18(25)12-6-2-3-7-13(12)19(23)26/h2-4,6-9,21H,5,10-11H2,1H3.
What are the key properties of 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione?
4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione has a molecular weight of 363.37 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,3-dioxoisoindol-2-yl)propylamino]-2-methylisoindole-1,3-dione is sourced from PubChem (CID 651812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).