About (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene
(3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene (PubChem CID 6518123) has the molecular formula C20H28Br2Cl6
and a molecular weight of 640.97 g/mol. Its IUPAC name is (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene.
Molecular Properties
| Compound Name | (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene |
| PubChem CID | 6518123 |
| Molecular Formula | C20H28Br2Cl6 |
| Molecular Weight | 640.97 g/mol |
| Exact Mass | 635.87 |
| IUPAC Name | (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene |
| SMILES | C=C(Cl)/C(=C\Cl)CCC(Br)C(C)(C)Cl.C=C(Cl)/C(=C\Cl)CCC(Br)C(C)(C)Cl |
| InChI | InChI=1S/2C10H14BrCl3/c2*1-7(13)8(6-12)4-5-9(11)10(2,3)14/h2*6,9H,1,4-5H2,2-3H3/b2*8-6- |
| InChIKey | USYDWFYCSNPBNV-HFSICSMJSA-N |
| XLogP | 10.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.97 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene?
The IUPAC name of (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene (CID 6518123) is (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene.
What is the SMILES notation for (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene?
The canonical SMILES for (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene is C=C(Cl)/C(=C\Cl)CCC(Br)C(C)(C)Cl.C=C(Cl)/C(=C\Cl)CCC(Br)C(C)(C)Cl.
What is the InChIKey of (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene?
The InChIKey is USYDWFYCSNPBNV-HFSICSMJSA-N. The full InChI is InChI=1S/2C10H14BrCl3/c2*1-7(13)8(6-12)4-5-9(11)10(2,3)14/h2*6,9H,1,4-5H2,2-3H3/b2*8-6-.
What are the key properties of (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene?
(3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene has a molecular weight of 640.97 g/mol, XLogP of 10.85, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-6-bromo-2,7-dichloro-3-(chloromethylidene)-7-methyloct-1-ene is sourced from PubChem (CID 6518123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).