About N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine
N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine (PubChem CID 65181733) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine |
| PubChem CID | 65181733 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine |
| SMILES | CNC(C)c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H14N2O/c1-9(13-2)12-14-8-11(15-12)10-6-4-3-5-7-10/h3-9,13H,1-2H3 |
| InChIKey | SGGCKYBNBKXEBG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine?
The IUPAC name of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine (CID 65181733) is N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine.
What is the SMILES notation for N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine?
The canonical SMILES for N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine is CNC(C)c1ncc(-c2ccccc2)o1.
What is the InChIKey of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine?
The InChIKey is SGGCKYBNBKXEBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-9(13-2)12-14-8-11(15-12)10-6-4-3-5-7-10/h3-9,13H,1-2H3.
What are the key properties of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine?
N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine has a molecular weight of 202.26 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine is sourced from PubChem (CID 65181733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).