C13H11F5N2O — CID 65181853
N-ethyl-1-[5-(2,3,4,5,6-pentafluorophenyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65181853) has the molecular formula C13H11F5N2O and a molecular weight of 306.23 g/mol. Its IUPAC name is N-ethyl-1-[5-(2,3,4,5,6-pentafluorophenyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | N-ethyl-1-[5-(2,3,4,5,6-pentafluorophenyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 65181853 |
| Molecular Formula | C13H11F5N2O |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-ethyl-1-[5-(2,3,4,5,6-pentafluorophenyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CCNC(C)c1ncc(-c2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C13H11F5N2O/c1-3-19-5(2)13-20-4-6(21-13)7-8(14)10(16)12(18)11(17)9(7)15/h4-5,19H,3H2,1-2H3 |
| InChIKey | HQQZMELCDQLHOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|