C27H36N4O3 — CID 6518338
(2S)-2-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]-3-phenylpropan-1-ol (PubChem CID 6518338) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is (2S)-2-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 6518338 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | (2S)-2-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]-3-phenylpropan-1-ol |
| SMILES | CC(C)[C@@H](OCc1ccccc1)[C@H](C)/C=N\O[C@@H](C)c1cn([C@H](CO)Cc2ccccc2)nn1 |
| InChI | InChI=1S/C27H36N4O3/c1-20(2)27(33-19-24-13-9-6-10-14-24)21(3)16-28-34-22(4)26-17-31(30-29-26)25(18-32)15-23-11-7-5-8-12-23/h5-14,16-17,20-22,25,27,32H,15,18-19H2,1-4H3/b28-16-/t21-,22+,25+,27-/m1/s1 |
| InChIKey | DBEDSIZKWMXGQI-JPTOOQBJSA-N |
| XLogP | 5.00 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|