C28H41NO3 — CID 6518340
(Z,2R,3R)-N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]-2,4-dimethyl-3-phenylmethoxypentan-1-imine (PubChem CID 6518340) has the molecular formula C28H41NO3 and a molecular weight of 439.64 g/mol. Its IUPAC name is (Z,2R,3R)-N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]-2,4-dimethyl-3-phenylmethoxypentan-1-imine.
| Compound Name | (Z,2R,3R)-N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]-2,4-dimethyl-3-phenylmethoxypentan-1-imine |
|---|---|
| PubChem CID | 6518340 |
| Molecular Formula | C28H41NO3 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | (Z,2R,3R)-N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]-2,4-dimethyl-3-phenylmethoxypentan-1-imine |
| SMILES | CC(C)[C@@H](OCc1ccccc1)[C@H](C)/C=N\OC[C@@H](C)[C@H](OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C28H41NO3/c1-21(2)27(30-19-25-13-9-7-10-14-25)23(5)17-29-32-18-24(6)28(22(3)4)31-20-26-15-11-8-12-16-26/h7-17,21-24,27-28H,18-20H2,1-6H3/b29-17-/t23-,24-,27-,28-/m1/s1 |
| InChIKey | MWTCQRUHLHPMAV-PMVDBGLNSA-N |
| XLogP | 6.74 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|