C13H21N7O2 — CID 651835
2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-N,N-diethylacetamide (PubChem CID 651835) has the molecular formula C13H21N7O2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-N,N-diethylacetamide.
| Compound Name | 2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 651835 |
| Molecular Formula | C13H21N7O2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C#N)c1nc(OC)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H21N7O2/c1-6-19(7-2)10(21)8-20(9-14)12-15-11(18(3)4)16-13(17-12)22-5/h6-8H2,1-5H3 |
| InChIKey | KAFQKYBXVNYWFF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 98.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|