About N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine
N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 65183731) has the molecular formula C14H17IN2O
and a molecular weight of 356.21 g/mol. Its IUPAC name is N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 65183731 |
| Molecular Formula | C14H17IN2O |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ncc(-c2cccc(I)c2)o1 |
| InChI | InChI=1S/C14H17IN2O/c1-14(2,3)17-9-13-16-8-12(18-13)10-5-4-6-11(15)7-10/h4-8,17H,9H2,1-3H3 |
| InChIKey | FAHMIYSERHGBOS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine (CID 65183731) is N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine is CC(C)(C)NCc1ncc(-c2cccc(I)c2)o1.
What is the InChIKey of N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine?
The InChIKey is FAHMIYSERHGBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17IN2O/c1-14(2,3)17-9-13-16-8-12(18-13)10-5-4-6-11(15)7-10/h4-8,17H,9H2,1-3H3.
What are the key properties of N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine?
N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine has a molecular weight of 356.21 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(3-iodophenyl)-1,3-oxazol-2-yl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 65183731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).