About N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine
N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine (PubChem CID 6518396) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine.
Molecular Properties
| Compound Name | N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine |
| PubChem CID | 6518396 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine |
| SMILES | CC(C)=NOC[C@@H](C)[C@H](OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C17H27NO2/c1-13(2)17(15(5)11-20-18-14(3)4)19-12-16-9-7-6-8-10-16/h6-10,13,15,17H,11-12H2,1-5H3/t15-,17-/m1/s1 |
| InChIKey | NBTXGNAABMFTFR-NVXWUHKLSA-N |
| XLogP | 4.28 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine?
The IUPAC name of N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine (CID 6518396) is N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine.
What is the SMILES notation for N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine?
The canonical SMILES for N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine is CC(C)=NOC[C@@H](C)[C@H](OCc1ccccc1)C(C)C.
What is the InChIKey of N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine?
The InChIKey is NBTXGNAABMFTFR-NVXWUHKLSA-N. The full InChI is InChI=1S/C17H27NO2/c1-13(2)17(15(5)11-20-18-14(3)4)19-12-16-9-7-6-8-10-16/h6-10,13,15,17H,11-12H2,1-5H3/t15-,17-/m1/s1.
What are the key properties of N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine?
N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine has a molecular weight of 277.41 g/mol, XLogP of 4.28, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]propan-2-imine is sourced from PubChem (CID 6518396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).