About 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine
2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 651844) has the molecular formula C19H19FN6
and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 651844 |
| Molecular Formula | C19H19FN6 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCCCn2ccnc2)n2nc(-c3ccc(F)cc3)cc2n1 |
| InChI | InChI=1S/C19H19FN6/c1-14-11-18(22-7-2-9-25-10-8-21-13-25)26-19(23-14)12-17(24-26)15-3-5-16(20)6-4-15/h3-6,8,10-13,22H,2,7,9H2,1H3 |
| InChIKey | BLLXAFQWCMYQSK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine (CID 651844) is 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine is Cc1cc(NCCCn2ccnc2)n2nc(-c3ccc(F)cc3)cc2n1.
What is the InChIKey of 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is BLLXAFQWCMYQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN6/c1-14-11-18(22-7-2-9-25-10-8-21-13-25)26-19(23-14)12-17(24-26)15-3-5-16(20)6-4-15/h3-6,8,10-13,22H,2,7,9H2,1H3.
What are the key properties of 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine?
2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 350.40 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 651844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).