C11H17F3N2O2 — CID 65184900
N-(2-methoxyethyl)-3-[5-(2,2,2-trifluoroethyl)-1,3-oxazol-2-yl]propan-1-amine (PubChem CID 65184900) has the molecular formula C11H17F3N2O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[5-(2,2,2-trifluoroethyl)-1,3-oxazol-2-yl]propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3-[5-(2,2,2-trifluoroethyl)-1,3-oxazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 65184900 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-(2-methoxyethyl)-3-[5-(2,2,2-trifluoroethyl)-1,3-oxazol-2-yl]propan-1-amine |
| SMILES | COCCNCCCc1ncc(CC(F)(F)F)o1 |
| InChI | InChI=1S/C11H17F3N2O2/c1-17-6-5-15-4-2-3-10-16-8-9(18-10)7-11(12,13)14/h8,15H,2-7H2,1H3 |
| InChIKey | QTXCZOVAJRMDGX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|