C13H20FNO — CID 65185897
2-(aminomethyl)-1-(4-fluoro-3-methylphenyl)-3-methylbutan-1-ol (PubChem CID 65185897) has the molecular formula C13H20FNO and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(4-fluoro-3-methylphenyl)-3-methylbutan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(4-fluoro-3-methylphenyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 65185897 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-(aminomethyl)-1-(4-fluoro-3-methylphenyl)-3-methylbutan-1-ol |
| SMILES | Cc1cc(C(O)C(CN)C(C)C)ccc1F |
| InChI | InChI=1S/C13H20FNO/c1-8(2)11(7-15)13(16)10-4-5-12(14)9(3)6-10/h4-6,8,11,13,16H,7,15H2,1-3H3 |
| InChIKey | DTAJFMMQYQBOAC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |