C17H23ClFNO — CID 65186189
4-amino-1-(2-bicyclo[2.2.1]heptanyl)-3-(2-chloro-6-fluorophenyl)butan-2-ol (PubChem CID 65186189) has the molecular formula C17H23ClFNO and a molecular weight of 311.83 g/mol. Its IUPAC name is 4-amino-1-(2-bicyclo[2.2.1]heptanyl)-3-(2-chloro-6-fluorophenyl)butan-2-ol.
| Compound Name | 4-amino-1-(2-bicyclo[2.2.1]heptanyl)-3-(2-chloro-6-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 65186189 |
| Molecular Formula | C17H23ClFNO |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4-amino-1-(2-bicyclo[2.2.1]heptanyl)-3-(2-chloro-6-fluorophenyl)butan-2-ol |
| SMILES | NCC(c1c(F)cccc1Cl)C(O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C17H23ClFNO/c18-14-2-1-3-15(19)17(14)13(9-20)16(21)8-12-7-10-4-5-11(12)6-10/h1-3,10-13,16,21H,4-9,20H2 |
| InChIKey | WABHMHSLOGKBQZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |