C18H26N2O — CID 65187177
3-[5-[2-(4-methylphenyl)ethyl]-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 65187177) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[5-[2-(4-methylphenyl)ethyl]-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[5-[2-(4-methylphenyl)ethyl]-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 65187177 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-[5-[2-(4-methylphenyl)ethyl]-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | Cc1ccc(CCc2cnc(CCCNC(C)C)o2)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-14(2)19-12-4-5-18-20-13-17(21-18)11-10-16-8-6-15(3)7-9-16/h6-9,13-14,19H,4-5,10-12H2,1-3H3 |
| InChIKey | JVRBYWRKROJGHZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|