C15H19ClN2O — CID 65187513
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 65187513) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 65187513 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCc1ncc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H19ClN2O/c1-11(2)17-9-5-8-15-18-10-14(19-15)12-6-3-4-7-13(12)16/h3-4,6-7,10-11,17H,5,8-9H2,1-2H3 |
| InChIKey | CLMBUHNAWMZKJZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|