C18H31NO2 — CID 65187810
1-amino-2-(4-ethoxyphenyl)-5,6,6-trimethylheptan-3-ol (PubChem CID 65187810) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-amino-2-(4-ethoxyphenyl)-5,6,6-trimethylheptan-3-ol.
| Compound Name | 1-amino-2-(4-ethoxyphenyl)-5,6,6-trimethylheptan-3-ol |
|---|---|
| PubChem CID | 65187810 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 1-amino-2-(4-ethoxyphenyl)-5,6,6-trimethylheptan-3-ol |
| SMILES | CCOc1ccc(C(CN)C(O)CC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H31NO2/c1-6-21-15-9-7-14(8-10-15)16(12-19)17(20)11-13(2)18(3,4)5/h7-10,13,16-17,20H,6,11-12,19H2,1-5H3 |
| InChIKey | RMDMOBOPFFATJQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |