C17H16BrNOS — CID 65188133
3-amino-1-(1-benzothiophen-3-yl)-2-(3-bromophenyl)propan-1-ol (PubChem CID 65188133) has the molecular formula C17H16BrNOS and a molecular weight of 362.29 g/mol. Its IUPAC name is 3-amino-1-(1-benzothiophen-3-yl)-2-(3-bromophenyl)propan-1-ol.
| Compound Name | 3-amino-1-(1-benzothiophen-3-yl)-2-(3-bromophenyl)propan-1-ol |
|---|---|
| PubChem CID | 65188133 |
| Molecular Formula | C17H16BrNOS |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 3-amino-1-(1-benzothiophen-3-yl)-2-(3-bromophenyl)propan-1-ol |
| SMILES | NCC(c1cccc(Br)c1)C(O)c1csc2ccccc12 |
| InChI | InChI=1S/C17H16BrNOS/c18-12-5-3-4-11(8-12)14(9-19)17(20)15-10-21-16-7-2-1-6-13(15)16/h1-8,10,14,17,20H,9,19H2 |
| InChIKey | WSEAUIVWQZPLCR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |