About 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol
2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol (PubChem CID 65188223) has the molecular formula C12H19NOS
and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol |
| PubChem CID | 65188223 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol |
| SMILES | CCC(CN)C(O)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C12H19NOS/c1-2-8(7-13)12(14)11-6-9-4-3-5-10(9)15-11/h6,8,12,14H,2-5,7,13H2,1H3 |
| InChIKey | CVMISLVPJHPBIR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol?
The IUPAC name of 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol (CID 65188223) is 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol.
What is the SMILES notation for 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol?
The canonical SMILES for 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol is CCC(CN)C(O)c1cc2c(s1)CCC2.
What is the InChIKey of 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol?
The InChIKey is CVMISLVPJHPBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NOS/c1-2-8(7-13)12(14)11-6-9-4-3-5-10(9)15-11/h6,8,12,14H,2-5,7,13H2,1H3.
What are the key properties of 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol?
2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol has a molecular weight of 225.36 g/mol, XLogP of 2.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)butan-1-ol is sourced from PubChem (CID 65188223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).