About 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol
1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol (PubChem CID 65189332) has the molecular formula C14H21F2NO
and a molecular weight of 257.32 g/mol. Its IUPAC name is 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol.
Molecular Properties
| Compound Name | 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol |
| PubChem CID | 65189332 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol |
| SMILES | CCC(C)(C)C(O)C(CN)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H21F2NO/c1-4-14(2,3)13(18)12(8-17)9-5-10(15)7-11(16)6-9/h5-7,12-13,18H,4,8,17H2,1-3H3 |
| InChIKey | ADMXLZQHNXYRKK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol?
The IUPAC name of 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol (CID 65189332) is 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol.
What is the SMILES notation for 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol?
The canonical SMILES for 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol is CCC(C)(C)C(O)C(CN)c1cc(F)cc(F)c1.
What is the InChIKey of 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol?
The InChIKey is ADMXLZQHNXYRKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F2NO/c1-4-14(2,3)13(18)12(8-17)9-5-10(15)7-11(16)6-9/h5-7,12-13,18H,4,8,17H2,1-3H3.
What are the key properties of 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol?
1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol has a molecular weight of 257.32 g/mol, XLogP of 2.80, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(3,5-difluorophenyl)-4,4-dimethylhexan-3-ol is sourced from PubChem (CID 65189332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).