C16H19F2NOS — CID 65189339
1-amino-2-(2,4-difluorophenyl)-6-thiophen-2-ylhexan-3-ol (PubChem CID 65189339) has the molecular formula C16H19F2NOS and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-amino-2-(2,4-difluorophenyl)-6-thiophen-2-ylhexan-3-ol.
| Compound Name | 1-amino-2-(2,4-difluorophenyl)-6-thiophen-2-ylhexan-3-ol |
|---|---|
| PubChem CID | 65189339 |
| Molecular Formula | C16H19F2NOS |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-amino-2-(2,4-difluorophenyl)-6-thiophen-2-ylhexan-3-ol |
| SMILES | NCC(c1ccc(F)cc1F)C(O)CCCc1cccs1 |
| InChI | InChI=1S/C16H19F2NOS/c17-11-6-7-13(15(18)9-11)14(10-19)16(20)5-1-3-12-4-2-8-21-12/h2,4,6-9,14,16,20H,1,3,5,10,19H2 |
| InChIKey | IJHSIXWZCPSLIZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |