About 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol
1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol (PubChem CID 65189382) has the molecular formula C13H19F2NO3S
and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol.
Molecular Properties
| Compound Name | 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol |
| PubChem CID | 65189382 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol |
| SMILES | CC(C)(C(O)C(CN)c1cc(F)cc(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C13H19F2NO3S/c1-13(2,20(3,18)19)12(17)11(7-16)8-4-9(14)6-10(15)5-8/h4-6,11-12,17H,7,16H2,1-3H3 |
| InChIKey | GSJRIYVMBPFYHI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol?
The IUPAC name of 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol (CID 65189382) is 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol.
What is the SMILES notation for 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol?
The canonical SMILES for 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol is CC(C)(C(O)C(CN)c1cc(F)cc(F)c1)S(C)(=O)=O.
What is the InChIKey of 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol?
The InChIKey is GSJRIYVMBPFYHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2NO3S/c1-13(2,20(3,18)19)12(17)11(7-16)8-4-9(14)6-10(15)5-8/h4-6,11-12,17H,7,16H2,1-3H3.
What are the key properties of 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol?
1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol has a molecular weight of 307.36 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(3,5-difluorophenyl)-4-methyl-4-methylsulfonylpentan-3-ol is sourced from PubChem (CID 65189382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).