C27H22Cl2N2O3S — CID 6518995
ethyl (2Z)-2-[(9E)-5-(2-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-3-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-2-ylidene]acetate (PubChem CID 6518995) has the molecular formula C27H22Cl2N2O3S and a molecular weight of 525.46 g/mol. Its IUPAC name is ethyl (2Z)-2-[(9E)-5-(2-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-3-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(9E)-5-(2-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-3-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-2-ylidene]acetate |
|---|---|
| PubChem CID | 6518995 |
| Molecular Formula | C27H22Cl2N2O3S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | ethyl (2Z)-2-[(9E)-5-(2-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-3-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=c1\sc2n(c1=O)C(c1ccccc1Cl)C1=C(N=2)/C(=C/c2ccccc2Cl)CCC1 |
| InChI | InChI=1S/C27H22Cl2N2O3S/c1-2-34-23(32)15-22-26(33)31-25(18-10-4-6-13-21(18)29)19-11-7-9-17(24(19)30-27(31)35-22)14-16-8-3-5-12-20(16)28/h3-6,8,10,12-15,25H,2,7,9,11H2,1H3/b17-14+,22-15- |
| InChIKey | CNGVIJUWOYVHNZ-ZXPGUXPCSA-N |
| XLogP | 5.30 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |