About N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide
N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide (PubChem CID 65191559) has the molecular formula C12H16F2N2O
and a molecular weight of 242.27 g/mol. Its IUPAC name is N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide |
| PubChem CID | 65191559 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide |
| SMILES | CC(C)C(CN)NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2N2O/c1-7(2)11(6-15)16-12(17)8-3-9(13)5-10(14)4-8/h3-5,7,11H,6,15H2,1-2H3,(H,16,17) |
| InChIKey | HZUOKFUIXRGHOY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide?
The IUPAC name of N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide (CID 65191559) is N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide.
What is the SMILES notation for N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide?
The canonical SMILES for N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide is CC(C)C(CN)NC(=O)c1cc(F)cc(F)c1.
What is the InChIKey of N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide?
The InChIKey is HZUOKFUIXRGHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2O/c1-7(2)11(6-15)16-12(17)8-3-9(13)5-10(14)4-8/h3-5,7,11H,6,15H2,1-2H3,(H,16,17).
What are the key properties of N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide?
N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide has a molecular weight of 242.27 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-3-methylbutan-2-yl)-3,5-difluorobenzamide is sourced from PubChem (CID 65191559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).