C9H16N2O3 — CID 65191991
4-(1-aminopentan-2-yl)morpholine-3,5-dione (PubChem CID 65191991) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(1-aminopentan-2-yl)morpholine-3,5-dione.
| Compound Name | 4-(1-aminopentan-2-yl)morpholine-3,5-dione |
|---|---|
| PubChem CID | 65191991 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 4-(1-aminopentan-2-yl)morpholine-3,5-dione |
| SMILES | CCCC(CN)N1C(=O)COCC1=O |
| InChI | InChI=1S/C9H16N2O3/c1-2-3-7(4-10)11-8(12)5-14-6-9(11)13/h7H,2-6,10H2,1H3 |
| InChIKey | XBMJPRQJNSSQOE-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|