About 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile
3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile (PubChem CID 65192078) has the molecular formula C14H15BrN4
and a molecular weight of 319.21 g/mol. Its IUPAC name is 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile.
Molecular Properties
| Compound Name | 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile |
| PubChem CID | 65192078 |
| Molecular Formula | C14H15BrN4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile |
| SMILES | Cc1nn(C)cc1C(C)Nc1ccc(C#N)cc1Br |
| InChI | InChI=1S/C14H15BrN4/c1-9(12-8-19(3)18-10(12)2)17-14-5-4-11(7-16)6-13(14)15/h4-6,8-9,17H,1-3H3 |
| InChIKey | NPHRUHHJFWNAAG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile?
The IUPAC name of 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile (CID 65192078) is 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile.
What is the SMILES notation for 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile?
The canonical SMILES for 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile is Cc1nn(C)cc1C(C)Nc1ccc(C#N)cc1Br.
What is the InChIKey of 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile?
The InChIKey is NPHRUHHJFWNAAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN4/c1-9(12-8-19(3)18-10(12)2)17-14-5-4-11(7-16)6-13(14)15/h4-6,8-9,17H,1-3H3.
What are the key properties of 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile?
3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile has a molecular weight of 319.21 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzonitrile is sourced from PubChem (CID 65192078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).