About N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline
N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline (PubChem CID 65192459) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline.
Molecular Properties
| Compound Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline |
| PubChem CID | 65192459 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(NC(C)c2cn(C)nc2C)c1 |
| InChI | InChI=1S/C15H21N3/c1-10-6-11(2)8-14(7-10)16-12(3)15-9-18(5)17-13(15)4/h6-9,12,16H,1-5H3 |
| InChIKey | JSJYINMSKGIXQK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline?
The IUPAC name of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline (CID 65192459) is N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline.
What is the SMILES notation for N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline?
The canonical SMILES for N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline is Cc1cc(C)cc(NC(C)c2cn(C)nc2C)c1.
What is the InChIKey of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline?
The InChIKey is JSJYINMSKGIXQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-10-6-11(2)8-14(7-10)16-12(3)15-9-18(5)17-13(15)4/h6-9,12,16H,1-5H3.
What are the key properties of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline?
N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline has a molecular weight of 243.35 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3,5-dimethylaniline is sourced from PubChem (CID 65192459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).