About N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide
N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 65192969) has the molecular formula C9H16N4O4S
and a molecular weight of 276.32 g/mol. Its IUPAC name is N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 65192969 |
| Molecular Formula | C9H16N4O4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | CCCC(CN)NS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H16N4O4S/c1-2-3-6(4-10)13-18(16,17)7-5-11-9(15)12-8(7)14/h5-6,13H,2-4,10H2,1H3,(H2,11,12,14,15) |
| InChIKey | JGNPENKROWSFHQ-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The IUPAC name of N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (CID 65192969) is N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide is CCCC(CN)NS(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The InChIKey is JGNPENKROWSFHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O4S/c1-2-3-6(4-10)13-18(16,17)7-5-11-9(15)12-8(7)14/h5-6,13H,2-4,10H2,1H3,(H2,11,12,14,15).
What are the key properties of N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide has a molecular weight of 276.32 g/mol, XLogP of -1.53, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopentan-2-yl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 65192969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).