C7H16N2O4S — CID 65193173
2-(1-aminopentan-2-ylsulfamoyl)acetic acid (PubChem CID 65193173) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(1-aminopentan-2-ylsulfamoyl)acetic acid.
| Compound Name | 2-(1-aminopentan-2-ylsulfamoyl)acetic acid |
|---|---|
| PubChem CID | 65193173 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-(1-aminopentan-2-ylsulfamoyl)acetic acid |
| SMILES | CCCC(CN)NS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C7H16N2O4S/c1-2-3-6(4-8)9-14(12,13)5-7(10)11/h6,9H,2-5,8H2,1H3,(H,10,11) |
| InChIKey | LOSNKEXSZQRYCB-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |