C11H15ClN2O — CID 65193613
N-(1-aminobutan-2-yl)-2-chlorobenzamide (PubChem CID 65193613) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-2-chlorobenzamide.
| Compound Name | N-(1-aminobutan-2-yl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 65193613 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(1-aminobutan-2-yl)-2-chlorobenzamide |
| SMILES | CCC(CN)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C11H15ClN2O/c1-2-8(7-13)14-11(15)9-5-3-4-6-10(9)12/h3-6,8H,2,7,13H2,1H3,(H,14,15) |
| InChIKey | WUMLVMUFUQGDGF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |