C14H16Br2N2O — CID 65193812
1-(4,5-dibromofuran-2-yl)-N-(1-phenylethyl)ethane-1,2-diamine (PubChem CID 65193812) has the molecular formula C14H16Br2N2O and a molecular weight of 388.10 g/mol. Its IUPAC name is 1-(4,5-dibromofuran-2-yl)-N-(1-phenylethyl)ethane-1,2-diamine.
| Compound Name | 1-(4,5-dibromofuran-2-yl)-N-(1-phenylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65193812 |
| Molecular Formula | C14H16Br2N2O |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 1-(4,5-dibromofuran-2-yl)-N-(1-phenylethyl)ethane-1,2-diamine |
| SMILES | CC(NC(CN)c1cc(Br)c(Br)o1)c1ccccc1 |
| InChI | InChI=1S/C14H16Br2N2O/c1-9(10-5-3-2-4-6-10)18-12(8-17)13-7-11(15)14(16)19-13/h2-7,9,12,18H,8,17H2,1H3 |
| InChIKey | JMGYBHRFSJISSB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |