C12H15Cl2N — CID 65194915
[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]methanamine (PubChem CID 65194915) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is [1-[(2,4-dichlorophenyl)methyl]cyclobutyl]methanamine.
| Compound Name | [1-[(2,4-dichlorophenyl)methyl]cyclobutyl]methanamine |
|---|---|
| PubChem CID | 65194915 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | [1-[(2,4-dichlorophenyl)methyl]cyclobutyl]methanamine |
| SMILES | NCC1(Cc2ccc(Cl)cc2Cl)CCC1 |
| InChI | InChI=1S/C12H15Cl2N/c13-10-3-2-9(11(14)6-10)7-12(8-15)4-1-5-12/h2-3,6H,1,4-5,7-8,15H2 |
| InChIKey | ZYUWJRQNMBBZBZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |