About 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline
3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline (PubChem CID 65197181) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline.
Molecular Properties
| Compound Name | 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline |
| PubChem CID | 65197181 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline |
| SMILES | CCC(C)Oc1cccc(NC(C)c2cn(C)nc2C)c1 |
| InChI | InChI=1S/C17H25N3O/c1-6-12(2)21-16-9-7-8-15(10-16)18-13(3)17-11-20(5)19-14(17)4/h7-13,18H,6H2,1-5H3 |
| InChIKey | LHWQLWIXOYUDGY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline?
The IUPAC name of 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline (CID 65197181) is 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline.
What is the SMILES notation for 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline?
The canonical SMILES for 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline is CCC(C)Oc1cccc(NC(C)c2cn(C)nc2C)c1.
What is the InChIKey of 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline?
The InChIKey is LHWQLWIXOYUDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O/c1-6-12(2)21-16-9-7-8-15(10-16)18-13(3)17-11-20(5)19-14(17)4/h7-13,18H,6H2,1-5H3.
What are the key properties of 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline?
3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline has a molecular weight of 287.41 g/mol, XLogP of 4.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yloxy-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]aniline is sourced from PubChem (CID 65197181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).