C9H15N3OS — CID 65199521
N-[(4-methylthiadiazol-5-yl)methyl]-1-(oxolan-2-yl)methanamine (PubChem CID 65199521) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is N-[(4-methylthiadiazol-5-yl)methyl]-1-(oxolan-2-yl)methanamine.
| Compound Name | N-[(4-methylthiadiazol-5-yl)methyl]-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 65199521 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-[(4-methylthiadiazol-5-yl)methyl]-1-(oxolan-2-yl)methanamine |
| SMILES | Cc1nnsc1CNCC1CCCO1 |
| InChI | InChI=1S/C9H15N3OS/c1-7-9(14-12-11-7)6-10-5-8-3-2-4-13-8/h8,10H,2-6H2,1H3 |
| InChIKey | JIHHAQCGNFKKIU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |