About N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide
N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide (PubChem CID 65199981) has the molecular formula C11H12N4OS
and a molecular weight of 248.31 g/mol. Its IUPAC name is N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide |
| PubChem CID | 65199981 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)N(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H12N4OS/c1-7-10(17-14-13-7)11(16)15(2)9-5-3-8(12)4-6-9/h3-6H,12H2,1-2H3 |
| InChIKey | IIWAZZONSBIXPD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide?
The IUPAC name of N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide (CID 65199981) is N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide.
What is the SMILES notation for N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide?
The canonical SMILES for N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide is Cc1nnsc1C(=O)N(C)c1ccc(N)cc1.
What is the InChIKey of N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide?
The InChIKey is IIWAZZONSBIXPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4OS/c1-7-10(17-14-13-7)11(16)15(2)9-5-3-8(12)4-6-9/h3-6H,12H2,1-2H3.
What are the key properties of N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide?
N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide has a molecular weight of 248.31 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminophenyl)-N,4-dimethylthiadiazole-5-carboxamide is sourced from PubChem (CID 65199981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).