C7H6ClN3OS — CID 65200009
2-(chloromethyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole (PubChem CID 65200009) has the molecular formula C7H6ClN3OS and a molecular weight of 215.66 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 65200009 |
| Molecular Formula | C7H6ClN3OS |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 2-(chloromethyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole |
| SMILES | Cc1nc(-c2nnc(CCl)o2)cs1 |
| InChI | InChI=1S/C7H6ClN3OS/c1-4-9-5(3-13-4)7-11-10-6(2-8)12-7/h3H,2H2,1H3 |
| InChIKey | PEEBLTRBKFWSNQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|