C14H15N3OS2 — CID 65200020
N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 65200020) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65200020 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)N(CCC(N)=S)c2ccccc2)cs1 |
| InChI | InChI=1S/C14H15N3OS2/c1-10-16-12(9-20-10)14(18)17(8-7-13(15)19)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,15,19) |
| InChIKey | VMXVMDMTLMAQFW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|