About N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide
N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 652004) has the molecular formula C20H33N3O2
and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide |
| PubChem CID | 652004 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)C1CCN(Cc2ccccc2O)CC1 |
| InChI | InChI=1S/C20H33N3O2/c1-20(2,15-22(3)4)14-21-19(25)16-9-11-23(12-10-16)13-17-7-5-6-8-18(17)24/h5-8,16,24H,9-15H2,1-4H3,(H,21,25) |
| InChIKey | LRXLNMZQHZJZBB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide?
The IUPAC name of N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide (CID 652004) is N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide.
What is the SMILES notation for N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide?
The canonical SMILES for N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide is CN(C)CC(C)(C)CNC(=O)C1CCN(Cc2ccccc2O)CC1.
What is the InChIKey of N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide?
The InChIKey is LRXLNMZQHZJZBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N3O2/c1-20(2,15-22(3)4)14-21-19(25)16-9-11-23(12-10-16)13-17-7-5-6-8-18(17)24/h5-8,16,24H,9-15H2,1-4H3,(H,21,25).
What are the key properties of N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide?
N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide has a molecular weight of 347.50 g/mol, XLogP of 2.31, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(2-hydroxyphenyl)methyl]piperidine-4-carboxamide is sourced from PubChem (CID 652004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).