C17H20ClFO — CID 65202199
1-(3-chloroprop-1-ynyl)-4-(3-ethylcyclohexyl)oxy-2-fluorobenzene (PubChem CID 65202199) has the molecular formula C17H20ClFO and a molecular weight of 294.80 g/mol. Its IUPAC name is 1-(3-chloroprop-1-ynyl)-4-(3-ethylcyclohexyl)oxy-2-fluorobenzene.
| Compound Name | 1-(3-chloroprop-1-ynyl)-4-(3-ethylcyclohexyl)oxy-2-fluorobenzene |
|---|---|
| PubChem CID | 65202199 |
| Molecular Formula | C17H20ClFO |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(3-chloroprop-1-ynyl)-4-(3-ethylcyclohexyl)oxy-2-fluorobenzene |
| SMILES | CCC1CCCC(Oc2ccc(C#CCCl)c(F)c2)C1 |
| InChI | InChI=1S/C17H20ClFO/c1-2-13-5-3-7-15(11-13)20-16-9-8-14(6-4-10-18)17(19)12-16/h8-9,12-13,15H,2-3,5,7,10-11H2,1H3 |
| InChIKey | HPCXFQIDMHMQNV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|