C18H17N3O2 — CID 652025
ethyl 2-(3,5-diphenyl-1,2,4-triazol-1-yl)acetate (PubChem CID 652025) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 2-(3,5-diphenyl-1,2,4-triazol-1-yl)acetate.
| Compound Name | ethyl 2-(3,5-diphenyl-1,2,4-triazol-1-yl)acetate |
|---|---|
| PubChem CID | 652025 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | ethyl 2-(3,5-diphenyl-1,2,4-triazol-1-yl)acetate |
| SMILES | CCOC(=O)Cn1nc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c1-2-23-16(22)13-21-18(15-11-7-4-8-12-15)19-17(20-21)14-9-5-3-6-10-14/h3-12H,2,13H2,1H3 |
| InChIKey | NUHOOPVZCRNWQQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |