About 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene
1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene (PubChem CID 65203003) has the molecular formula C8H6BrF3O
and a molecular weight of 255.03 g/mol. Its IUPAC name is 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene |
| PubChem CID | 65203003 |
| Molecular Formula | C8H6BrF3O |
| Molecular Weight | 255.03 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene |
| SMILES | Fc1cc(OCC(F)F)ccc1Br |
| InChI | InChI=1S/C8H6BrF3O/c9-6-2-1-5(3-7(6)10)13-4-8(11)12/h1-3,8H,4H2 |
| InChIKey | AXSISZWZQSDNRN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.03 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene?
The IUPAC name of 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene (CID 65203003) is 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene.
What is the SMILES notation for 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene?
The canonical SMILES for 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene is Fc1cc(OCC(F)F)ccc1Br.
What is the InChIKey of 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene?
The InChIKey is AXSISZWZQSDNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrF3O/c9-6-2-1-5(3-7(6)10)13-4-8(11)12/h1-3,8H,4H2.
What are the key properties of 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene?
1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene has a molecular weight of 255.03 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(2,2-difluoroethoxy)-2-fluorobenzene is sourced from PubChem (CID 65203003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).