About N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide
N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide (PubChem CID 652031) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide |
| PubChem CID | 652031 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide |
| SMILES | Cc1cccc(OCC(=O)Nc2cc(C)c(C)cc2O)c1 |
| InChI | InChI=1S/C17H19NO3/c1-11-5-4-6-14(7-11)21-10-17(20)18-15-8-12(2)13(3)9-16(15)19/h4-9,19H,10H2,1-3H3,(H,18,20) |
| InChIKey | XSQGEWWAHMOYLD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide?
The IUPAC name of N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide (CID 652031) is N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide.
What is the SMILES notation for N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide?
The canonical SMILES for N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide is Cc1cccc(OCC(=O)Nc2cc(C)c(C)cc2O)c1.
What is the InChIKey of N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide?
The InChIKey is XSQGEWWAHMOYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-11-5-4-6-14(7-11)21-10-17(20)18-15-8-12(2)13(3)9-16(15)19/h4-9,19H,10H2,1-3H3,(H,18,20).
What are the key properties of N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide?
N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide has a molecular weight of 285.34 g/mol, XLogP of 3.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-4,5-dimethylphenyl)-2-(3-methylphenoxy)acetamide is sourced from PubChem (CID 652031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).