C20H22ClN5OS — CID 6520418
4-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-methyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 6520418) has the molecular formula C20H22ClN5OS and a molecular weight of 415.95 g/mol. Its IUPAC name is 4-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-methyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-methyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 6520418 |
| Molecular Formula | C20H22ClN5OS |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-5-methyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | Cc1nn(CN2CCCCC2)c(=S)n1/N=C\c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H22ClN5OS/c1-15-23-25(14-24-11-3-2-4-12-24)20(28)26(15)22-13-18-9-10-19(27-18)16-5-7-17(21)8-6-16/h5-10,13H,2-4,11-12,14H2,1H3/b22-13- |
| InChIKey | FTROCYMSHFJYIR-XKZIYDEJSA-N |
| XLogP | 4.96 |
| TPSA | 51.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|